L-371,257
SMILES | COc1cc(ccc1C(=O)N1CCC(CC1)N1C(=O)OCc2c1cccc2)OC1CCN(CC1)C(=O)C |
InChIKey | WDERJSQJYIJOPD-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 0 |
Rotatable bonds | 5 |
Molecular weight (Da) | 507.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.8 | 8.8 | 8.8 | Guide to Pharmacology |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 8.43 | 8.43 | 8.43 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 7.72 | 7.72 | 7.72 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.7 | 8.12 | 8.34 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.5 | 5.5 | 5.5 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 4.43 | 4.43 | 4.43 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 6.19 | 6.19 | 6.19 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pEC50 | 8.34 | 8.34 | 8.34 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pEC50 | 5.5 | 5.5 | 5.5 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 4.43 | 4.43 | 4.43 | ChEMBL |