Ro4491533
SMILES | O=C1CC(=Nc2c(N1)cc(c(c2)C)C(F)(F)F)c1cccc(c1)c1cc(C)nc(c1)C |
InChIKey | LYTVXCQQTLUEQR-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 423.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 8.27 | 8.27 | 8.27 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.44 | 7.33 | 8.21 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 6.53 | 7.62 | 8.7 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pIC50 | 6.6 | 6.6 | 6.6 | Guide to Pharmacology |
mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pIC50 | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pIC50 | 6.57 | 6.57 | 6.57 | ChEMBL |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 8.52 | 8.61 | 8.7 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 6.53 | 6.97 | 7.85 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 7.85 | 7.85 | 7.85 | Guide to Pharmacology |