BNTX
SMILES | O=C1/C(=C\c2ccccc2)/C[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O |
InChIKey | WXOUFNFMPVMGFZ-XEGDMQTMSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 2 |
Rotatable bonds | 3 |
Molecular weight (Da) | 429.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.8 | 8.8 | 8.8 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.43 | 8.59 | 8.74 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.43 | 8.7 | 9.18 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 7.26 | 7.84 | 8.43 | PDSP Ki database |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.15 | 8.15 | 8.15 | PDSP Ki database |
μ | OPRM | Human | Opioid | A | pKi | 7.74 | 8.25 | 8.77 | PDSP Ki database |
μ | OPRM | Human | Opioid | A | pKi | 8.72 | 8.72 | 8.72 | ChEMBL |
δ | OPRD | Mouse | Opioid | A | pKi | 9.2 | 9.2 | 9.2 | Guide to Pharmacology |
κ | OPRK | Guinea pig | Opioid | A | pKi | 7.18 | 7.32 | 7.47 | ChEMBL |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 8.38 | 8.38 | 8.38 | PDSP Ki database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |