compound 29 [PMID: 17064898]
| SMILES | OCC1CCN(CC1)c1ncc(nc1)C(=O)NC1CCCCC1 |
| InChIKey | JKQOZEOZKKMWQL-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 318.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 8.03 | 8.03 | 8.03 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 8.05 | 8.05 | 8.05 | Guide to Pharmacology |