(S)-4C3HPG
SMILES | N[C@@H](c1ccc(c(c1)O)C(=O)O)C(=O)O |
InChIKey | GXZSAQLJWLCLOX-ZETCQYMHSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 4 |
Rotatable bonds | 3 |
Molecular weight (Da) | 211.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 4.8 | 4.8 | 4.8 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 5.8 | 5.9 | 6.0 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 5.6 | 5.6 | 5.6 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 4.4 | 4.4 | 4.4 | ChEMBL |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 4.4 | 4.4 | 4.4 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 4.32 | 4.32 | 4.32 | ChEMBL |