pethidine
SMILES | CCOC(=O)C1(CCN(CC1)C)c1ccccc1 |
InChIKey | XADCESSVHJOZHK-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 0 |
Rotatable bonds | 3 |
Molecular weight (Da) | 247.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pKi | 6.04 | 6.04 | 6.04 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pKi | 5.0 | 5.52 | 6.04 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 8.25 | 8.25 | 8.25 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.22 | 8.22 | 8.22 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pIC50 | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pIC50 | 5.63 | 5.63 | 5.63 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pIC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pIC50 | 5.62 | 5.62 | 5.62 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 6.5 | 6.5 | 6.5 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 5.03 | 5.03 | 5.03 | ChEMBL |