Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[D-Arg1,D-Trp7,9,Leu11]substance P | 1322 | None | 0 | Rat | Binding | pKi | = | - | 4.95 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Phe12]bombesin | 1477 | None | 0 | Rat | Binding | pKi | = | - | 5.00 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Phe6, Leu13, Cpa14,ψ13-14]bombesin-(6-14) | 1481 | None | 0 | Human | Binding | pKi | = | - | 9.80 | 263 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/19463875 | |
[D-Phe6, Leu13, Cpa14,ψ13-14]bombesin-(6-14) | 1481 | None | 0 | Rat | Binding | pKi | = | - | 7.38 | -263 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Phe6,β-Ala11,Phe13,Nle14]bombesin-(6-14) | 1478 | None | 0 | Human | Binding | pKi | = | - | 7.91 | -12 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 | |
[D-Phe6,β-Ala11,Phe13,Nle14]bombesin-(6-14) | 1478 | None | 0 | Human | Binding | pKi | = | - | 7.91 | -12 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/31743956 | |
[D-Phe6]bombesin(6-13)methyl ester | 1479 | None | 0 | Human | Binding | pKi | > | - | 5.00 | -1000 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 | |
[D-Phe6]bombesin(6-13)methyl ester | 1479 | None | 0 | Rat | Binding | pKi | = | - | 8.00 | 1000 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Phe6]bombesin(6-13)propylamide | 1480 | None | 0 | Rat | Binding | pKi | = | - | 8.22 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Pro4,D-Trp7,9,10]substance P (4-11) | 1483 | None | 0 | Rat | Binding | pKi | > | - | 5.00 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[D-Tyr6,β-Ala11,N-Me-Ala13,Nle14]bombesin-(6-14) | 1504 | None | 0 | Human | Binding | pKi | = | - | 9.50 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/31743956 | |
[Leu14, ψ 13-14)]bombesin | 2301 | None | 0 | Human | Binding | pKi | = | - | 8.11 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7838118 | |
[Leu8]-phyllolitorin | 2307 | None | 0 | Rat | Binding | pKi | = | - | 6.38 | 23 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9325344 | |
[Leu8]-phyllolitorin | 2307 | None | 0 | Rat | Binding | pKi | = | - | 6.38 | 23 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
[Phe13]bombesin | 3102 | None | 0 | Human | Binding | pKi | = | - | 8.14 | -9 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 | |
[Phe13]bombesin | 3102 | None | 0 | Rat | Binding | pKi | = | - | 9.11 | 9 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9325344 | |
[Phe13]bombesin | 3102 | None | 0 | Rat | Binding | pKi | = | - | 9.11 | 9 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10353842 | |
AM-37 | 382 | None | 0 | Human | Binding | pKi | = | - | 5.85 | - | 2 | Measuring inhibition of specific [125]I-BA1 binding to hBB2 receptor in vitro. | Guide to Pharmacology | 525.3 | 9 | 4 | 4 | 5.32 | COc1ccc(NC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCC2(c3cccnc3)CCCCC2)cc1 | https://pubmed.ncbi.nlm.nih.gov/28785244 | |
bag-1 | 569 | None | 23 | Human | Binding | IC50 | = | 6400.00 | 5.19 | - | 5 | Displacement of [125I]D-Tyr6-betaAla11-Phe13-Nle14-bombesin from human GRP-R expressed in NFAT-CHO cells after 2 hrs by scintillation counting | ChEMBL | 333.2 | 7 | 1 | 2 | 5.24 | CCC(C)(C)Cc1cnc(CCc2ccc(-c3ccccn3)cc2)[nH]1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.076 | |
bombesin | 704 | None | 34 | Human | Binding | pKi | = | - | 8.11 | 2 | 6 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 |
Showing 1 to 20 of 275 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |