Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL182554 | 65228 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 2 | Binding affinity against human Melanin-concentrating hormone receptor 2 stably transfected CHO cells was determined using [125I]MCH as radioligand | ChEMBL | 502.3 | 10 | 3 | 5 | 5.74 | COc1cc(NC(=O)Nc2ccc(Oc3ccccc3)cc2)ccc1C(=O)NCCCN1CCCCC1 | https://dx.doi.org/10.1016/j.bmcl.2004.07.077 | |
CHEMBL184292 | 66192 | None | 0 | Human | Binding | IC50 | = | 6310.00 | 5.20 | - | 2 | Binding affinity against human Melanin-concentrating hormone receptor 2 stably transfected CHO cells was determined using [125I]MCH as radioligand | ChEMBL | 458.2 | 8 | 3 | 4 | 5.34 | CCN1CCCC1CNC(=O)c1ccc(NC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.07.077 | |
CHEMBL184438 | 66227 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 2 | Binding affinity against human Melanin-concentrating hormone receptor 2 stably transfected CHO cells was determined using [125I]MCH as radioligand | ChEMBL | 501.3 | 10 | 4 | 5 | 5.69 | COc1cc(NC(=O)Nc2cccc(Nc3ccccc3)c2)ccc1C(=O)NCCCN1CCCCC1 | https://dx.doi.org/10.1016/j.bmcl.2004.07.077 | |
CHEMBL186894 | 67017 | None | 0 | Human | Binding | IC50 | = | 2880.00 | 5.54 | - | 2 | Binding affinity against human Melanin-concentrating hormone receptor 2 stably transfected CHO cells was determined using [125I]MCH as radioligand | ChEMBL | 549.3 | 10 | 3 | 5 | 5.67 | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1ccc(C(=O)NCCN2CCN(Cc3ccccc3)CC2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.07.077 | |
CHEMBL1934130 | 69576 | None | 0 | Human | Binding | Ki | = | 13.00 | 7.89 | - | 2 | Displacement of [3H]N-(1'-((9-ethyl-9H-carbazol-3-yl)methyl)-2,3-dihydrospiro[indene-1,4'-piperidine]-3-yl)acetamide from human MCHR2 expressed in HEK293 cells after 2 hrs | ChEMBL | 466.2 | 3 | 2 | 4 | 4.84 | CC(=O)N[C@@H]1CC2(CCN(Cc3ccc4c(c3)c3ccccc3n4C(N)=O)CC2)c2ccccc21 | https://dx.doi.org/10.1016/j.bmcl.2011.10.125 | |
CHEMBL194408 | 70332 | None | 0 | Human | Binding | IC50 | = | 4.50 | 8.35 | - | 2 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 460.1 | 8 | 1 | 5 | 4.87 | Cc1cc(N(C)CCN(C)C)nc2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL194837 | 70585 | None | 0 | Human | Binding | IC50 | = | 8.70 | 8.06 | - | 11 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 447.1 | 8 | 1 | 5 | 4.81 | Cc1cc(OCCN(C)C)nc2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL195635 | 71220 | None | 0 | Human | Binding | IC50 | = | 6.30 | 8.20 | - | 2 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 528.2 | 7 | 1 | 6 | 5.52 | Cc1cc(N2CCC(N3CCCC3)CC2)nc2ccc(NC(=O)COc3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL196196 | 71485 | None | 0 | Human | Binding | IC50 | = | 8.40 | 8.08 | - | 3 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 458.2 | 8 | 2 | 5 | 5.07 | Cc1cc(NCCN(C)C)nc2ccc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL196581 | 71748 | None | 0 | Human | Binding | IC50 | = | 7.10 | 8.15 | - | 3 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 476.2 | 10 | 2 | 6 | 4.82 | Cc1cc(NCCCN(C)C)nc2ccc(NC(=O)COc3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL196667 | 71783 | None | 0 | Human | Binding | IC50 | = | 3.70 | 8.43 | - | 3 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 444.1 | 5 | 2 | 5 | 4.28 | Cc1cc(N2CCNCC2)nc2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL197026 | 71886 | None | 0 | Human | Binding | IC50 | = | 4.70 | 8.33 | - | 2 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 474.2 | 6 | 2 | 6 | 4.39 | Cc1cc(N2CCC(N)CC2)nc2ccc(NC(=O)COc3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL197050 | 71895 | None | 0 | Human | Binding | IC50 | = | 6.40 | 8.19 | - | 2 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 445.2 | 7 | 2 | 5 | 4.52 | Cc1cc(N(C)CCO)nc2ccc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL217480 | 82470 | None | 0 | Human | Binding | IC50 | = | 960.00 | 6.02 | - | 2 | Displacement of 125I-[Phe13,Tyr19]-MCH from human MCH-R2 | ChEMBL | 453.2 | 7 | 2 | 3 | 6.82 | CCCc1cc(NC2CCC2)c2cc(NC(=O)/C=C/c3ccc(C(F)(F)F)cc3)ccc2n1 | https://dx.doi.org/10.1016/j.bmcl.2006.08.008 | |
CHEMBL373084 | 135936 | None | 0 | Human | Binding | IC50 | = | 6.80 | 8.17 | - | 3 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 446.1 | 8 | 2 | 5 | 4.52 | CNCCN(C)c1cc(C)c2cc(NC(=O)COc3ccc(Cl)cc3Cl)ccc2n1 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL427540 | 166471 | None | 0 | Human | Binding | IC50 | = | 6.80 | 8.17 | - | 2 | Displacement of 15 pM [125I]-MCH from human MCH2R expressed in CHO-K1 in whole-cell binding assay | ChEMBL | 472.2 | 6 | 2 | 6 | 4.01 | Cc1cc(N2CC3CC2CN3)nc2ccc(NC(=O)COc3ccc(OC(F)(F)F)cc3)cc12 | https://dx.doi.org/10.1021/jm050103y | |
CHEMBL540930 | 195697 | None | 0 | Human | Binding | IC50 | = | 4600.00 | 5.34 | - | 2 | Displacement of [125I]MCH from human MCHR2 expressed in CHO cells | ChEMBL | 600.2 | 8 | 2 | 4 | 6.49 | O=C(CC1CCN(Cc2ccn(-c3ccc(C(F)(F)F)cc3)c2)CC1)NC(c1ccc(F)cc1)c1c[nH]c(=O)c(Cl)c1 | https://dx.doi.org/10.1016/j.bmcl.2009.05.067 | |
CHEMBL557629 | 198218 | None | 0 | Human | Binding | Ki | = | 1.60 | 8.80 | -46 | 3 | Displacement of [35S] 4-(1-(3,4-difluorophenyl)-2-(ethyl(3-(6-fluoro-3H-spiro[isobenzofuran-1,4'-piperidine]-1'-yl)propyl)amino)-2-oxoethyl)-3-oxopiperazine-1-sulfonic acid from human MCH2R | ChEMBL | 2419.1 | 58 | 33 | 31 | -3.45 | CSCC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H]1CSSC[C@@H](C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCC(N)=O)CN[C@@H](Cc2ccc(O)cc2)C(=O)O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC1=O | https://dx.doi.org/10.1016/j.bmcl.2009.03.102 |
Showing 1 to 18 of 18 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |