Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL3604476 | 122785 | None | 0 | Human | Binding | IC50 | = | 1310.00 | 5.88 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 416.1 | 4 | 2 | 4 | 5.21 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604481 | 122791 | None | 0 | Human | Binding | IC50 | = | 1750.00 | 5.76 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 432.1 | 4 | 2 | 4 | 4.44 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2c(O)ccc[n+]2[O-])cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604483 | 122793 | None | 0 | Human | Binding | IC50 | = | 330.00 | 6.48 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 446.1 | 5 | 3 | 5 | 4.70 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccc(CO)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604486 | 122796 | None | 0 | Human | Binding | IC50 | = | 23.00 | 7.64 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 416.1 | 4 | 2 | 5 | 4.48 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccnc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604487 | 122797 | None | 0 | Human | Binding | IC50 | = | 23.00 | 7.64 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 416.1 | 4 | 2 | 5 | 4.48 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nnccc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604488 | 122798 | None | 0 | Human | Binding | IC50 | = | 750.00 | 6.12 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 417.1 | 4 | 2 | 5 | 4.60 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncncc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604489 | 122799 | None | 0 | Human | Binding | IC50 | = | 30.00 | 7.52 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 432.1 | 4 | 3 | 6 | 4.18 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nc(N)ncc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604492 | 122803 | None | 0 | Human | Binding | IC50 | = | 340.00 | 6.47 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 432.1 | 4 | 3 | 6 | 4.18 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncnc(N)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604493 | 122804 | None | 0 | Human | Binding | IC50 | = | 105.00 | 6.98 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 460.1 | 5 | 2 | 6 | 4.67 | CN(C)c1ncnc(-c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1O | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604494 | 122805 | None | 0 | Human | Binding | IC50 | = | 190.00 | 6.72 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 501.2 | 5 | 2 | 7 | 4.31 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nncc(N3CCOCC3)c2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604495 | 122806 | None | 0 | Human | Binding | IC50 | = | 325.00 | 6.49 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 447.1 | 5 | 3 | 6 | 4.09 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncnc(CO)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604496 | 122807 | None | 0 | Human | Binding | IC50 | = | 60.00 | 7.22 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 445.1 | 5 | 2 | 5 | 5.16 | CCc1ncnc(-c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1O | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604497 | 122808 | None | 0 | Human | Binding | IC50 | = | 235.00 | 6.63 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 430.1 | 5 | 2 | 5 | 4.94 | CNc1nccnc1-c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604499 | 122810 | None | 0 | Human | Binding | IC50 | = | 34.00 | 7.47 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by buffer chemotaxis assay | ChEMBL | 460.1 | 7 | 3 | 6 | 4.30 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccnc2NCCO)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604499 | 122810 | None | 0 | Human | Binding | IC50 | = | 170.00 | 6.77 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) by serum chemotaxis assay | ChEMBL | 460.1 | 7 | 3 | 6 | 4.30 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccnc2NCCO)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3797858 | 139750 | None | 0 | Human | Binding | Ki | = | 357.00 | 6.45 | - | 1 | Antagonist activity at CCR9 receptor in human MOLT4 cells assessed as inhibition of CCl25-mediated cell migration preincubated for 30 mins followed CCL25 addition incubated for 2 hrs by ChemoTx plate system | ChEMBL | 483.1 | 5 | 1 | 5 | 4.63 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c2C(=O)N(Cc2cccnc2)C3=O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01840 | |
CHEMBL3798178 | 139798 | None | 0 | Human | Binding | Ki | = | 40.00 | 7.40 | - | 1 | Antagonist activity at CCR9 receptor in human MOLT4 cells assessed as inhibition of CCl25-mediated cell migration preincubated for 30 mins followed CCL25 addition incubated for 2 hrs by ChemoTx plate system | ChEMBL | 499.1 | 5 | 1 | 5 | 3.87 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c2C(=O)N(Cc2cccc[n+]2[O-])C3=O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01840 | |
CHEMBL3798368 | 139829 | None | 0 | Human | Binding | Ki | = | 113.00 | 6.95 | - | 1 | Antagonist activity at CCR9 receptor in human MOLT4 cells assessed as inhibition of CCl25-mediated cell migration preincubated for 30 mins followed CCL25 addition incubated for 2 hrs by ChemoTx plate system | ChEMBL | 515.1 | 5 | 1 | 6 | 3.88 | COc1c(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)ccc[n+]1[O-] | https://dx.doi.org/10.1021/acs.jmedchem.5b01840 | |
CHEMBL3798612 | 139864 | None | 0 | Human | Binding | Ki | = | 9.00 | 8.05 | - | 1 | Antagonist activity at CCR9 receptor in human MOLT4 cells assessed as inhibition of CCl25-mediated cell migration preincubated for 30 mins followed CCL25 addition incubated for 2 hrs by ChemoTx plate system | ChEMBL | 469.1 | 4 | 1 | 5 | 4.63 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c2C(=O)N(c2ccccn2)C3=O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01840 | |
CHEMBL3799111 | 139928 | None | 0 | Human | Binding | Ki | = | 19.00 | 7.72 | - | 1 | Antagonist activity at CCR9 receptor in human MOLT4 cells assessed as inhibition of CCl25-mediated cell migration preincubated for 30 mins followed CCL25 addition incubated for 2 hrs by ChemoTx plate system | ChEMBL | 483.1 | 4 | 1 | 5 | 4.94 | Cc1cccc(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)n1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01840 |
Showing 1 to 20 of 42 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL3604474 | 122783 | None | 0 | Human | Functional | IC50 | = | 2500.00 | 5.60 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 430.1 | 5 | 1 | 4 | 5.51 | COc1ccnc(-c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604475 | 122784 | None | 0 | Human | Functional | IC50 | = | 958.00 | 6.02 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 430.1 | 5 | 1 | 4 | 5.51 | COc1cccnc1-c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604476 | 122785 | None | 0 | Human | Functional | IC50 | = | 29.00 | 7.54 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 416.1 | 4 | 2 | 4 | 5.21 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604477 | 122786 | None | 0 | Human | Functional | IC50 | = | 95.00 | 7.02 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 415.1 | 4 | 2 | 4 | 5.08 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604478 | 122787 | None | 0 | Human | Functional | IC50 | = | 89.00 | 7.05 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 430.1 | 5 | 2 | 4 | 4.99 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccc2CO)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604479 | 122788 | None | 0 | Human | Functional | IC50 | = | 3163.00 | 5.50 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 429.1 | 5 | 2 | 4 | 4.96 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccc2CN)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604480 | 122790 | None | 0 | Human | Functional | IC50 | = | 3477.00 | 5.46 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 444.1 | 6 | 1 | 4 | 5.65 | COCc1cccnc1-c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604481 | 122791 | None | 0 | Human | Functional | IC50 | = | 491.00 | 6.31 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 432.1 | 4 | 2 | 4 | 4.44 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2c(O)ccc[n+]2[O-])cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604482 | 122792 | None | 0 | Human | Functional | IC50 | = | 52.00 | 7.28 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 459.1 | 5 | 3 | 5 | 4.30 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccc(C(N)=O)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604483 | 122793 | None | 0 | Human | Functional | IC50 | = | 8.70 | 8.06 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 446.1 | 5 | 3 | 5 | 4.70 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccc(CO)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604484 | 122794 | None | 0 | Human | Functional | IC50 | = | 0.30 | 9.52 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 401.1 | 4 | 1 | 4 | 4.89 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncccn2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604485 | 122795 | None | 0 | Human | Functional | IC50 | = | 3.20 | 8.49 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 416.1 | 4 | 2 | 5 | 4.48 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncncc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604486 | 122796 | None | 0 | Human | Functional | IC50 | = | 3.20 | 8.49 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 416.1 | 4 | 2 | 5 | 4.48 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nccnc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604487 | 122797 | None | 0 | Human | Functional | IC50 | = | 3.80 | 8.42 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 416.1 | 4 | 2 | 5 | 4.48 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nnccc2N)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604488 | 122798 | None | 0 | Human | Functional | IC50 | = | 11.00 | 7.96 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 417.1 | 4 | 2 | 5 | 4.60 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncncc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604489 | 122799 | None | 0 | Human | Functional | IC50 | = | 4.00 | 8.40 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 432.1 | 4 | 3 | 6 | 4.18 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nc(N)ncc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604490 | 122801 | None | 0 | Human | Functional | IC50 | = | 27.00 | 7.57 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 446.1 | 5 | 3 | 6 | 4.64 | CNc1ncc(O)c(-c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604491 | 122802 | None | 0 | Human | Functional | IC50 | = | 214.00 | 6.67 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 476.1 | 7 | 4 | 7 | 4.00 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2nc(NCCO)ncc2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604492 | 122803 | None | 0 | Human | Functional | IC50 | = | 14.00 | 7.85 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 432.1 | 4 | 3 | 6 | 4.18 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2-c2ncnc(N)c2O)cc1 | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 | |
CHEMBL3604493 | 122804 | None | 0 | Human | Functional | IC50 | = | 9.00 | 8.05 | - | 1 | Antagonist activity at CCR9 receptor (unknown origin) assessed as inhibition of TECK-induced calcium mobilization incubated for 10 mins prior to TECK induction | ChEMBL | 460.1 | 5 | 2 | 6 | 4.67 | CN(C)c1ncnc(-c2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1O | https://dx.doi.org/10.1016/j.bmcl.2015.06.046 |
Showing 1 to 20 of 234 entries