Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1672755 | 58077 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 2 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 224.0 | 1 | 2 | 5 | 0.73 | CCc1cc(=O)oc2nc(S)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL2036813 | 75261 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 5 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 236.1 | 3 | 2 | 4 | 0.51 | CCCCc1cc(=O)oc2[nH]c(=O)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL3185583 | 107552 | None | 63 | Rat | Binding | EC50 | = | 30000.00 | 4.52 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 100.1 | 3 | 1 | 1 | 1.04 | C=CCCC(=O)O | - | |
CHEMBL3188068 | 107600 | None | 10 | Rat | Binding | EC50 | = | 3000.00 | 5.52 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 140.0 | 3 | 0 | 2 | -3.07 | CCCCC(=O)[O-].[K+] | - | |
CHEMBL3890404 | 142569 | None | 7 | Rat | Binding | EC50 | = | 50000.00 | 4.30 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 126.0 | 2 | 0 | 2 | -3.46 | CCCC(=O)[O-].[K+] | - | |
CHEMBL3913375 | 145418 | None | 9 | Rat | Binding | EC50 | = | 30000.00 | 4.52 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 154.0 | 4 | 0 | 2 | -2.68 | CCCCCC(=O)[O-].[K+] | - | |
CHEMBL3925414 | 146975 | None | 9 | Rat | Binding | EC50 | = | 100000.00 | 4.00 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 168.1 | 5 | 0 | 2 | -2.29 | CCCCCCC(=O)[O-].[K+] | - | |
CHEMBL4530642 | 173609 | None | 0 | Rat | Binding | EC50 | = | 407.38 | 6.39 | - | 3 | Agonist activity at rat FFA3 receptor | ChEMBL | 418.1 | 3 | 2 | 3 | 5.62 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(C2CCCC2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4530642 | 173609 | None | 0 | Mouse | Binding | EC50 | = | 1096.48 | 5.96 | - | 3 | Agonist activity at mouse FFA3 receptor | ChEMBL | 418.1 | 3 | 2 | 3 | 5.62 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(C2CCCC2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4564389 | 175006 | None | 32 | Rat | Binding | EC50 | = | 457.09 | 6.34 | - | 3 | Agonist activity at rat FFA3 receptor | ChEMBL | 416.1 | 3 | 2 | 4 | 5.19 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4564389 | 175006 | None | 32 | Mouse | Binding | EC50 | = | 1318.26 | 5.88 | - | 3 | Agonist activity at mouse FFA3 receptor | ChEMBL | 416.1 | 3 | 2 | 4 | 5.19 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL5270112 | 193728 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 3 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 252.1 | 3 | 2 | 4 | 1.88 | CCCCc1cc(=O)oc2[nH]c(=S)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5275861 | 193981 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 3 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 286.0 | 4 | 2 | 4 | 2.10 | O=c1cc(CCCCCl)c2c(=O)[nH]c(=S)[nH]c2o1 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5277000 | 194030 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 2 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 238.0 | 2 | 2 | 4 | 1.49 | CCCc1cc(=O)oc2[nH]c(=S)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5281556 | 194224 | None | 11 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 2 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 210.0 | 0 | 2 | 4 | 0.85 | Cc1cc(=O)oc2[nH]c(=S)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5284951 | 194381 | None | 0 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 3 | Agonist activity at FFA3 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 270.0 | 4 | 2 | 4 | 0.73 | O=c1[nH]c(=O)c2c(CCCCCl)cc(=O)oc2[nH]1 | https://dx.doi.org/10.1039/d2md00076h | |
FHQC | 1637 | None | 18 | Rat | Binding | EC50 | = | 1348.96 | 5.87 | - | 3 | Agonist activity at rat FFA3 receptor | ChEMBL | 362.2 | 3 | 2 | 4 | 4.20 | CC1=C(C(=O)Nc2ccccc2C)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
FHQC | 1637 | None | 18 | Mouse | Binding | EC50 | = | 3801.89 | 5.42 | - | 3 | Agonist activity at mouse FFA3 receptor | ChEMBL | 362.2 | 3 | 2 | 4 | 4.20 | CC1=C(C(=O)Nc2ccccc2C)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
isobutyric acid | 2089 | None | 44 | Rat | Binding | EC50 | = | 30000.00 | 4.52 | - | 3 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 88.1 | 1 | 1 | 1 | 0.73 | CC(C)C(=O)O | - | |
SODIUM PROPIONATE | 188442 | None | 49 | Rat | Binding | EC50 | = | 5000.00 | 5.30 | - | 1 | Agonist activity at rat GPR41 expressed in Saccharomyces cerevisiae MMY22 co-expressing chimeric Gpa1/Galpha0 by induction of FUSl-lacZ and FUS1-HIS3 reporter gene induction based pheromone response pathway coupled assay | ChEMBL | 96.0 | 1 | 0 | 2 | -3.85 | CCC(=O)[O-].[Na+] | - |
Showing 1 to 20 of 20 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
1-methylcyclopropanecarboxylic acid | 34 | None | 66 | Human | Functional | pEC50 | = | - | 3.90 | 47 | 2 | Unclassified | Guide to Pharmacology | 100.1 | 1 | 1 | 1 | 0.87 | CC1(C(=O)O)CC1 | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
1-methylcyclopropanecarboxylic acid | 34 | None | 66 | Human | Functional | EC50 | = | 22387.21 | 4.65 | 47 | 2 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 100.1 | 1 | 1 | 1 | 0.87 | CC1(C(=O)O)CC1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | 4.92 | 8.31 | -3 | 2 | Agonist activity at human GPCR41 transfected in HEK293 cells assessed as [35S]GTPgammaS binding by scintillation counting method | Drug Central | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | - | |
acetic acid | 254 | None | 52 | Human | Functional | EC50 | = | 12000.00 | 4.92 | -3 | 2 | Agonist activity at human GPCR41 transfected in HEK293 cells assessed as [35S]GTPgammaS binding by scintillation counting method | ChEMBL | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00244 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.35 | -3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12496283 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.35 | -3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12711604 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.35 | -3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/14722361 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.35 | -3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 4.35 | 7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12496283 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 4.35 | 7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12711604 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 4.35 | 7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/14722361 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 4.35 | 7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
butyric acid | 750 | None | 54 | Human | Functional | EC50 | = | 12000.00 | 4.92 | 7 | 3 | Agonist activity at human GPCR41 transfected in HEK293 cells assessed as [35S]GTPgammaS binding by scintillation counting method | ChEMBL | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00244 | |
CHEMBL4436229 | 169698 | None | 0 | Human | Functional | EC50 | = | 144.54 | 6.84 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 392.1 | 4 | 2 | 3 | 5.23 | CCCC1C(C(=O)Nc2cc(Cl)ccc2Cl)=C(C)NC2=C1C(=O)CCC2 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4439667 | 169928 | None | 0 | Human | Functional | EC50 | = | 1000.00 | 6.00 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 412.2 | 3 | 2 | 4 | 5.35 | CC1=C(C(=O)Nc2ccccc2C)C(c2cc3ccccc3o2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4440699 | 169996 | None | 0 | Human | Functional | EC50 | = | 7762.47 | 5.11 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cell membrane assessed as stimulation of [35S]-GTPgammaS binding measured after 1 hr in presence of GDP by liquid scintillation spectrometry | ChEMBL | 348.1 | 3 | 2 | 4 | 3.89 | CC1=C(C(=O)Nc2ccccc2)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4440699 | 169996 | None | 0 | Human | Functional | EC50 | = | 3548.13 | 5.45 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 348.1 | 3 | 2 | 4 | 3.89 | CC1=C(C(=O)Nc2ccccc2)C(c2ccco2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4440835 | 170006 | None | 0 | Human | Functional | EC50 | = | 645.65 | 6.19 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 372.2 | 4 | 2 | 3 | 4.89 | CCCC1C(C(=O)Nc2cc(C)ccc2Cl)=C(C)NC2=C1C(=O)CCC2 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4442868 | 170144 | None | 0 | Human | Functional | EC50 | = | 251.19 | 6.60 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 390.1 | 3 | 2 | 3 | 4.84 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(C2CC2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 | |
CHEMBL4443263 | 170177 | None | 0 | Human | Functional | EC50 | = | 1659.59 | 5.78 | - | 1 | Agonist activity at human FFA3 receptor stably expressed in Flp-In T-Rex HEK293 cells cotransfected with eYFP assessed as inhibition of forskolin-induced cAMP production measured after 1 hr by fluorescence plate reader assay | ChEMBL | 417.1 | 3 | 2 | 5 | 4.59 | CC1=C(C(=O)Nc2cc(Cl)ccc2Cl)C(c2cocn2)C2=C(CCCC2=O)N1 | https://dx.doi.org/10.1021/acs.jmedchem.9b02036 |
Showing 1 to 20 of 109 entries