Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 12R-HETE | 11 | None | 0 | Human | Binding | pKi | = | - | 7.50 | - | 1 | Unclassified | Guide to Pharmacology | 320.2 | 14 | 2 | 2 | 5.19 | CCCCC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/9177352 | |
| 20-hydroxy-LTB4 | 41 | None | 0 | Human | Binding | pKi | = | - | 8.10 | - | 1 | Unclassified | Guide to Pharmacology | 352.2 | 15 | 4 | 4 | 3.13 | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCCO | https://pubmed.ncbi.nlm.nih.gov/9177352 | |
| 5, 6-Dehydroarachidonic acid | 218693 | 3H-LTB4 | 0 | Human | Binding | pKi | = | 1000.00 | 6.00 | 1 | 2 | - | PDSP KiDatabase | 302.2 | 12 | 1 | 1 | 5.66 | CCCCCC=CCC=CCC=CCC#CCCCC(=O)O | - | |
| BIIL 260 | 634 | None | 0 | Human | Binding | pKi | = | - | 8.80 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/11259574 | |
| BIIL 260 | 634 | None | 0 | Human | Binding | pKi | = | - | 8.80 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/17170051 | |
| CHEMBL105139 | 5027 | None | 14 | Human | Binding | IC50 | = | 210.00 | 6.68 | - | 1 | Tested for inhibitory activity against leukotriene B4 (LTB4) receptor in human neutrophils | ChEMBL | 299.1 | 3 | 2 | 5 | 3.65 | CNc1nc2c(Cc3cccnc3)c(C)c(O)c(C)c2s1 | https://dx.doi.org/10.1021/jm00045a011 | |
| CHEMBL106055 | 5190 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 316.1 | 10 | 1 | 2 | 5.11 | O=C(O)CCCCCCc1csc(CCc2ccccc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL107760 | 5629 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 364.1 | 11 | 1 | 2 | 6.15 | O=C(O)CCCCCCc1ccsc1CCCc1ccc(Cl)cc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL107781 | 5650 | None | 0 | Human | Binding | IC50 | = | 5000.00 | 5.30 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 346.2 | 11 | 2 | 3 | 5.21 | O=C(O)CCCCCCc1csc(CCCc2ccc(O)cc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL108094 | 6148 | None | 0 | Human | Binding | IC50 | = | 3500.00 | 5.46 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 302.1 | 9 | 1 | 2 | 4.72 | O=C(O)CCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL108415 | 6867 | None | 3 | Human | Binding | IC50 | = | 60.00 | 7.22 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 358.2 | 11 | 1 | 2 | 6.14 | CC(C)(CCCCCc1sccc1CCCc1ccccc1)C(=O)O | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109015 | 7906 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 364.1 | 11 | 1 | 2 | 6.15 | O=C(O)CCCCCCc1csc(CCCc2ccc(Cl)cc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109016 | 7907 | None | 0 | Human | Binding | IC50 | = | 4500.00 | 5.35 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 316.1 | 10 | 1 | 2 | 5.11 | O=C(O)CCCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109128 | 8089 | None | 0 | Human | Binding | IC50 | = | 6000.00 | 5.22 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 346.2 | 11 | 2 | 3 | 4.99 | O=C(O)CCCCCC(O)c1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109129 | 8091 | None | 0 | Human | Binding | IC50 | = | 3000.00 | 5.52 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 362.1 | 11 | 1 | 3 | 5.97 | Cc1cc(CCCc2ccccc2)c(SCCCCCC(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109176 | 8140 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 330.2 | 11 | 1 | 2 | 5.50 | O=C(O)CCCCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110243 | 9179 | None | 0 | Human | Binding | IC50 | = | 200.00 | 6.70 | - | 1 | Capability of compound to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 372.2 | 11 | 1 | 2 | 6.45 | Cc1cc(CCCc2ccccc2)c(CCCCCC(C)(C)C(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110402 | 9203 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability of compound to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptors at the concentration of 10e-5 M | ChEMBL | 330.2 | 11 | 1 | 2 | 5.50 | O=C(O)CCCCCCc1ccsc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110707 | 9244 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 406.2 | 12 | 1 | 2 | 7.17 | O=C(O)CCCCCCc1sc(-c2ccccc2)cc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110708 | 9245 | None | 0 | Human | Binding | IC50 | = | 1500.00 | 5.82 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 344.2 | 11 | 1 | 2 | 5.81 | Cc1cc(CCCc2ccccc2)c(CCCCCCC(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
Showing 1 to 20 of 510 entries
| Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |