Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
1012 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
1013 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
1057 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
5757 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
CHEMBL135 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
DB00783 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | |
1012 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
1013 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
1057 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
5757 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
CHEMBL135 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
DB00783 | 25 | 86 | None | 7079 | 4 | Human | 9.5 | pEC50 | = | 9.5 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | |
1014 | 1706 | 27 | None | - | 1 | Human | 5.8 | pEC50 | = | 5.8 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/acsmedchemlett.8b00212 | |
5322399 | 1706 | 27 | None | - | 1 | Human | 5.8 | pEC50 | = | 5.8 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/acsmedchemlett.8b00212 | |
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 5.8 | pEC50 | = | 5.8 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/acsmedchemlett.8b00212 | |
71937602 | 164376 | 1 | None | - | 1 | Human | 5.8 | pEC50 | = | 5.8 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 403 | 4 | 2 | 3 | 5.4 | O=C(Nc1ncc(Cc2ccc(F)cc2F)s1)c1[nH]c2ccccc2c1Cl | 10.1021/acsmedchemlett.8b00212 | |
CHEMBL4212956 | 164376 | 1 | None | - | 1 | Human | 5.8 | pEC50 | = | 5.8 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 403 | 4 | 2 | 3 | 5.4 | O=C(Nc1ncc(Cc2ccc(F)cc2F)s1)c1[nH]c2ccccc2c1Cl | 10.1021/acsmedchemlett.8b00212 | |
1014 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | |
5322399 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | |
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetryAgonist activity at GFP-tagged GPR30 expressed in COS7 cells assessed as half life for increase in intracellular calcium level by spectrofluorimetry |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | |
1014 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | |
5322399 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | |
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.7 | pEC50 | = | 8.7 | Functional | Agonist activity at GPR30 (unknown origin) by calcium mobilization assayAgonist activity at GPR30 (unknown origin) by calcium mobilization assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | |
25481402 | 163650 | 4 | None | - | 1 | Human | 7.7 | pEC50 | = | 7.7 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 369 | 4 | 2 | 3 | 4.7 | O=C(Nc1ncc(Cc2ccc(F)cc2)s1)c1cc2cc(F)ccc2[nH]1 | 10.1021/acsmedchemlett.8b00212 | |
CHEMBL4204236 | 163650 | 4 | None | - | 1 | Human | 7.7 | pEC50 | = | 7.7 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 369 | 4 | 2 | 3 | 4.7 | O=C(Nc1ncc(Cc2ccc(F)cc2)s1)c1cc2cc(F)ccc2[nH]1 | 10.1021/acsmedchemlett.8b00212 | |
135351819 | 163675 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 397 | 3 | 2 | 3 | 5.2 | CCc1nc(NC(=O)c2[nH]c3ccc(Br)cc3c2Cl)sc1C | 10.1021/acsmedchemlett.8b00212 | |
CHEMBL4204670 | 163675 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Agonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assayAgonist activity at GPER (unknown origin) expressed in human HL60 cells assessed as increase in cAMP accumulation in presence of IBMX after 15 mins by HTRF assay |
ChEMBL | 397 | 3 | 2 | 3 | 5.2 | CCc1nc(NC(=O)c2[nH]c3ccc(Br)cc3c2Cl)sc1C | 10.1021/acsmedchemlett.8b00212 | |
3320 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
7433743 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
CHEMBL583543 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of G1-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
3320 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
7433743 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
CHEMBL583543 | 1707 | 36 | None | - | 1 | Human | 6.7 | pIC50 | = | 6.7 | Functional | Antagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilizationAntagonist activity at GPR30 in human SKBr3 cells assessed as inhibition of E2-mediated calcium mobilization |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | |
60203890 | 189965 | 0 | None | - | 0 | Human | 8.0 | pKi | = | 8.0 | Functional | Agonist activity at GPER (unknown origin)Agonist activity at GPER (unknown origin) |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1C(c1cc3c(cc1Br)OCO3)N2 | 10.1016/j.ejmech.2022.114658 | |
CHEMBL5170710 | 189965 | 0 | None | - | 0 | Human | 8.0 | pKi | = | 8.0 | Functional | Agonist activity at GPER (unknown origin)Agonist activity at GPER (unknown origin) |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1C(c1cc3c(cc1Br)OCO3)N2 | 10.1016/j.ejmech.2022.114658 | |
2351 | 3286 | 64 | None | 16 | 27 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 473 | 7 | 2 | 6 | 6.1 | Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O | None | |
2820 | 3286 | 64 | None | 16 | 27 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 473 | 7 | 2 | 6 | 6.1 | Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O | None | |
5035 | 3286 | 64 | None | 16 | 27 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 473 | 7 | 2 | 6 | 6.1 | Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O | None | |
CHEMBL81 | 3286 | 64 | None | 16 | 27 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 473 | 7 | 2 | 6 | 6.1 | Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O | None | |
DB00481 | 3286 | 64 | None | 16 | 27 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 473 | 7 | 2 | 6 | 6.1 | Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O | None | |
1015 | 1700 | 0 | None | - | 1 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | None | |
104741 | 1700 | 0 | None | - | 1 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | None | |
1255 | 1700 | 0 | None | - | 1 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | None | |
CHEMBL1358 | 1700 | 0 | None | - | 1 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | None | |
DB00947 | 1700 | 0 | None | - | 1 | Human | 8.2 | pEC50 | = | 8.2 | Functional | NoneNone |
Drug Central | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | None | |
1012 | 25 | 86 | None | 7079 | 4 | Human | 8.0 | pEC50 | = | 8.0 | Functional | NoneNone |
Drug Central | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | None | |
1013 | 25 | 86 | None | 7079 | 4 | Human | 8.0 | pEC50 | = | 8.0 | Functional | NoneNone |
Drug Central | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | None | |
1057 | 25 | 86 | None | 7079 | 4 | Human | 8.0 | pEC50 | = | 8.0 | Functional | NoneNone |
Drug Central | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | None | |
5757 | 25 | 86 | None | 7079 | 4 | Human | 8.0 | pEC50 | = | 8.0 | Functional | NoneNone |
Drug Central | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | None | |
CHEMBL135 | 25 | 86 | None | 7079 | 4 | Human | 8.0 | pEC50 | = | 8.0 | Functional | NoneNone |
Drug Central | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | None |
Showing 1 to 50 of 62 entries
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
1014 | 1706 | 27 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm9011802 | ||
5322399 | 1706 | 27 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm9011802 | ||
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm9011802 | ||
3320 | 1707 | 36 | None | - | 1 | Human | 7.7 | pIC50 | = | 7.7 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1021/jm9011802 | ||
7433743 | 1707 | 36 | None | - | 1 | Human | 7.7 | pIC50 | = | 7.7 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1021/jm9011802 | ||
CHEMBL583543 | 1707 | 36 | None | - | 1 | Human | 7.7 | pIC50 | = | 7.7 | Binding | Binding affinity to GPR30Binding affinity to GPR30 |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1021/jm9011802 | ||
1014 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | ||
5322399 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | ||
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio775 | ||
1014 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | ||
5322399 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | ||
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.0 | pKi | = | 8.0 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1021/jm400132d | ||
1012 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
1013 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
1057 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
5757 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
CHEMBL135 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
DB00783 | 25 | 86 | None | - | 1 | Human | 8.6 | pKi | = | 8.6 | Binding | Competitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysisCompetitive binding affinity to G-protein coupled estrogen receptor (unknown origin) expressed in COS7 cells by E2 Alexa 633 staining based fluorescence analysis |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1039/C5MD00455A | ||
3320 | 1707 | 36 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | ||
7433743 | 1707 | 36 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | ||
CHEMBL583543 | 1707 | 36 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 369 | 1 | 1 | 3 | 5.0 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CC=C2 | 10.1038/nchembio.168 | ||
1012 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
1013 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
1057 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
5757 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
CHEMBL135 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
DB00783 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Displacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACSDisplacement of E2-Alexa633 from GFP-tagged GPR30 expressed in COS7 cells by FACS |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1038/nchembio775 | ||
1012 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
1013 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
1057 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
5757 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
CHEMBL135 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
DB00783 | 25 | 86 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Inhibition of estrogen binding to GPR30 (unknown origin)Inhibition of estrogen binding to GPR30 (unknown origin) |
ChEMBL | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 10.1021/jm400132d | ||
1014 | 1706 | 27 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio.168 | ||
5322399 | 1706 | 27 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio.168 | ||
CHEMBL569766 | 1706 | 27 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | Binding affinity to GPR30 in human Hec50 cells by competitive binding assayBinding affinity to GPR30 in human Hec50 cells by competitive binding assay |
ChEMBL | 411 | 2 | 1 | 4 | 5.2 | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@@H](N2)c1cc2OCOc2cc1Br | 10.1038/nchembio.168 | ||
12058 | 79 | 0 | None | - | 1 | Human | 8.0 | pKd | = | 8 | Binding | Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i>Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i> |
Guide to Pharmacology | 302 | 1 | 2 | 3 | 3.6 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCc1cc(c(cc31)OC)O | 24262995 | ||
66414 | 79 | 0 | None | - | 1 | Human | 8.0 | pKd | = | 8 | Binding | Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i>Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i> |
Guide to Pharmacology | 302 | 1 | 2 | 3 | 3.6 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCc1cc(c(cc31)OC)O | 24262995 | ||
CHEMBL299613 | 79 | 0 | None | - | 1 | Human | 8.0 | pKd | = | 8 | Binding | Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i>Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i> |
Guide to Pharmacology | 302 | 1 | 2 | 3 | 3.6 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCc1cc(c(cc31)OC)O | 24262995 | ||
DB02342 | 79 | 0 | None | - | 1 | Human | 8.0 | pKd | = | 8 | Binding | Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i>Specific binding affinity of [<sup>3</sup>H]2ME2 to GPER <i>in vitro</i> |
Guide to Pharmacology | 302 | 1 | 2 | 3 | 3.6 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCc1cc(c(cc31)OC)O | 24262995 | ||
1012 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
1013 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
1057 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
5757 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
CHEMBL135 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
DB00783 | 25 | 86 | None | - | 1 | Human | 8.6 | pKd | = | 8.6 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 272 | 0 | 2 | 2 | 3.6 | Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | 15539556 | ||
1015 | 1700 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | 15539556 | ||
104741 | 1700 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | 15539556 | ||
1255 | 1700 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | 15539556 | ||
CHEMBL1358 | 1700 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7 | Binding | UnclassifiedUnclassified |
Guide to Pharmacology | 606 | 14 | 2 | 3 | 8.7 | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O | 15539556 |
Showing 1 to 50 of 77 entries