Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 10883396 | 3649 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 5283560 | 3649 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 911 | 3649 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| CHEMBL225155 | 3649 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 2921 | 1422 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 44317142 | 1422 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 644260 | 1422 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| CHEMBL78494 | 1422 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 5512 | 1430 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Guide to Pharmacology | 701 | 36 | 2 | 6 | 11.6 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O | 12618218 | ||
| 9547172 | 1430 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Guide to Pharmacology | 701 | 36 | 2 | 6 | 11.6 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O | 12618218 | ||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |