Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL224729 | 85145 | None | 0 | Human | Binding | Ki | = | 6.76 | 8.17 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 588.3 | 7 | 2 | 5 | 7.03 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C1CCc3ccccc3CC1)N=C2C1CCOCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242391 | 92212 | None | 0 | Human | Binding | Ki | = | 2818.38 | 5.55 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 466.2 | 5 | 3 | 3 | 6.05 | N=C(N)Nc1cccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)c1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242567 | 92242 | None | 0 | Human | Binding | Ki | = | 3.80 | 8.42 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 532.3 | 8 | 2 | 4 | 7.43 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(Cc1ccccc1)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242589 | 92256 | None | 0 | Human | Binding | Ki | = | 676.08 | 6.17 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 481.2 | 6 | 2 | 4 | 5.64 | NCC(=O)Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242590 | 92257 | None | 0 | Human | Binding | Ki | = | 288.40 | 6.54 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 492.3 | 5 | 2 | 5 | 6.12 | O=C1N(Cc2ccccc2)N=C(C2CCCCC2)c2ccccc2N1c1ccc(NC2=NCCN2)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242778 | 92353 | None | 0 | Human | Binding | Ki | = | 154.88 | 6.81 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 480.3 | 5 | 3 | 3 | 6.36 | Cc1ccc2c(c1)N(c1ccc(NC(=N)N)cc1)C(=O)N(Cc1ccccc1)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL242784 | 92354 | None | 0 | Human | Binding | Ki | = | 13.18 | 7.88 | 8 | 2 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 456.3 | 6 | 2 | 4 | 5.86 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL243698 | 92858 | None | 0 | Human | Binding | Ki | = | 3.55 | 8.45 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 484.3 | 7 | 2 | 4 | 6.64 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C(C)C)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244074 | 92995 | None | 0 | Human | Binding | Ki | = | 6.76 | 8.17 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 484.3 | 8 | 2 | 4 | 6.64 | CCCN1N=C(C2CCCCC2)c2ccc(C)cc2N(c2ccc(NCCc3ncc[nH]3)cc2)C1=O | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244325 | 93188 | None | 0 | Human | Binding | Ki | = | 0.91 | 9.04 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 586.3 | 7 | 2 | 4 | 8.18 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C1CCc3ccccc3CC1)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244735 | 93272 | None | 0 | Human | Binding | Ki | = | 616.60 | 6.21 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 458.2 | 6 | 2 | 5 | 4.71 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C)N=C2C1CCOCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244930 | 93315 | None | 0 | Human | Binding | Ki | = | 3388.44 | 5.47 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 460.2 | 5 | 3 | 3 | 5.52 | N=C(N)Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(c3ccccc3)c3ccccc32)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244931 | 93316 | None | 0 | Human | Binding | Ki | = | 562.34 | 6.25 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 480.3 | 6 | 3 | 3 | 6.44 | N=C(N)Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(CC3CCCCC3)c3ccccc32)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL244956 | 93324 | None | 0 | Human | Binding | Ki | = | 6.61 | 8.18 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 526.3 | 7 | 2 | 5 | 6.41 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL245110 | 93345 | None | 0 | Human | Binding | Ki | = | 50.12 | 7.30 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 442.2 | 5 | 2 | 4 | 5.82 | Cc1ccc2c(c1)N(c1ccc(NCc3ncc[nH]3)cc1)C(=O)N(C)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL276472 | 98596 | None | 0 | Human | Binding | Kd | = | 1.26 | 8.90 | - | 1 | Binding affinity to human PTH receptor expressed in OK-1 cells | ChEMBL | 4285.2 | 148 | 58 | 57 | -13.33 | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](/C=C(\Cl)[C@H](C)N)C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(N)=O)C(C)C)C(C)C)C(C)C | https://dx.doi.org/10.1021/acs.jmedchem.7b01788 | |
CHEMBL387792 | 142135 | None | 0 | Human | Binding | Ki | = | 380.19 | 6.42 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 523.3 | 7 | 2 | 4 | 6.67 | CC(C)C(N)C(=O)Nc1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL387793 | 142136 | None | 0 | Human | Binding | Ki | = | 83.18 | 7.08 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 500.3 | 9 | 2 | 5 | 5.88 | COCCN1N=C(C2CCCCC2)c2ccc(C)cc2N(c2ccc(NCCc3ncc[nH]3)cc2)C1=O | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL388909 | 142452 | None | 0 | Human | Binding | Ki | = | 933.25 | 6.03 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 556.3 | 7 | 3 | 3 | 7.64 | N=C(N)Nc1ccc(Cc2ccc(N3C(=O)N(Cc4ccccc4)N=C(C4CCCCC4)c4ccccc43)cc2)cc1 | https://dx.doi.org/10.1021/jm0707626 | |
CHEMBL388911 | 142453 | None | 0 | Human | Binding | Ki | = | 8.71 | 8.06 | - | 1 | Displacement of [125I]-[Nle,8,18 Tyr34]-hPTH(1-34) from human recombinant PTH1R expressed in HEK293 cells | ChEMBL | 590.3 | 7 | 2 | 6 | 7.07 | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C1COc3ccccc3OC1)N=C2C1CCCCC1 | https://dx.doi.org/10.1021/jm0707626 |
Showing 1 to 20 of 42 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |