Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 1079 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
| 1079 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
| 5024764 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
| 5024764 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
| CHEMBL1256697 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
| CHEMBL1256697 | 901 | 44 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
| 2997 | 193151 | 35 | None | -13 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Functional | Drug Central | 270 | 1 | 1 | 2 | 3.1 | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 | None | ||
| CHEMBL523 | 193151 | 35 | None | -13 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Functional | Drug Central | 270 | 1 | 1 | 2 | 3.1 | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 | None | ||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |