Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
carbamazepine | 796 | None | 68 | Human | Binding | pKd | = | - | 4.77 | -1 | 8 | Binding affinity for FZD8 cysteine-rich domain (CRD) by SPR analysis. | Guide to Pharmacology | 236.1 | 0 | 1 | 1 | 3.39 | NC(=O)N1c2ccccc2C=Cc2ccccc21 | https://pubmed.ncbi.nlm.nih.gov/32049522 | |
carbamazepine | 796 | None | 68 | Human | Binding | pKd | = | 4.77 | 8.32 | -1 | 8 | Binding affinity for FZD8 cysteine-rich domain (CRD) by SPR analysis. | Drug Central | 236.1 | 0 | 1 | 1 | 3.39 | NC(=O)N1c2ccccc2C=Cc2ccccc21 | - | |
carbamazepine | 796 | None | 68 | Mouse | Binding | Kd | = | 16800.00 | 4.78 | -81 | 8 | Binding affinity to immobilized mouse C-terminal Rhinovirus 3C cleavage site-fused 6xHis-tagged Frizzled-8 CRD (Q33 to G173 resideus) transfected with pDisplay_BirA-ER plasmid in HEK293T cells for biotinylation by surface plasmon resonance assay | ChEMBL | 236.1 | 0 | 1 | 1 | 3.39 | NC(=O)N1c2ccccc2C=Cc2ccccc21 | https://dx.doi.org/10.1021/acs.jmedchem.9b02020 |
Showing 1 to 3 of 3 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |