Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 10197 | 3972 | 0 | None | -14 | 5 | Human | 8.0 | pIC50 | ~ | 8 | Functional | Guide to Pharmacology | None | None | None | None | 22753465 | ||||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 2554 | 796 | 119 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | |||
| 489 | 796 | 119 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | |||
| 5339 | 796 | 119 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | |||
| CHEMBL108 | 796 | 119 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | |||
| DB00564 | 796 | 119 | None | -81 | 8 | Mouse | 4.8 | pKd | = | 4.8 | Binding | ChEMBL | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 10.1021/acs.jmedchem.9b02020 | |||
| 2554 | 796 | 119 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | |||
| 489 | 796 | 119 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | |||
| 5339 | 796 | 119 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | |||
| CHEMBL108 | 796 | 119 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | |||
| DB00564 | 796 | 119 | None | -1 | 8 | Human | 8.3 | pKd | = | 8.3 | Binding | Drug Central | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | None | |||
| 2554 | 796 | 119 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | |||
| 489 | 796 | 119 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | |||
| 5339 | 796 | 119 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | |||
| CHEMBL108 | 796 | 119 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | |||
| DB00564 | 796 | 119 | None | -1 | 8 | Human | 4.8 | pKd | = | 4.8 | Binding | Guide to Pharmacology | 236 | 0 | 1 | 1 | 3.4 | NC(=O)N1c2ccccc2C=Cc2c1cccc2 | 32049522 | |||